C16H13N3O4S — CID 121082151
1-(1,3-benzodioxol-5-yl)-3-(4-methoxy-1,3-benzothiazol-2-yl)urea (PubChem CID 121082151) has the molecular formula C16H13N3O4S and a molecular weight of 343.36 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(4-methoxy-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(4-methoxy-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 121082151 |
| Molecular Formula | C16H13N3O4S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(4-methoxy-1,3-benzothiazol-2-yl)urea |
| SMILES | COc1cccc2sc(NC(=O)Nc3ccc4c(c3)OCO4)nc12 |
| InChI | InChI=1S/C16H13N3O4S/c1-21-11-3-2-4-13-14(11)18-16(24-13)19-15(20)17-9-5-6-10-12(7-9)23-8-22-10/h2-7H,8H2,1H3,(H2,17,18,19,20) |
| InChIKey | BEDRTRPFNPYIGR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |