C16H12F3N3O2S — CID 121082158
1-(4-methoxy-1,3-benzothiazol-2-yl)-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 121082158) has the molecular formula C16H12F3N3O2S and a molecular weight of 367.35 g/mol. Its IUPAC name is 1-(4-methoxy-1,3-benzothiazol-2-yl)-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(4-methoxy-1,3-benzothiazol-2-yl)-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 121082158 |
| Molecular Formula | C16H12F3N3O2S |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 1-(4-methoxy-1,3-benzothiazol-2-yl)-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | COc1cccc2sc(NC(=O)Nc3cccc(C(F)(F)F)c3)nc12 |
| InChI | InChI=1S/C16H12F3N3O2S/c1-24-11-6-3-7-12-13(11)21-15(25-12)22-14(23)20-10-5-2-4-9(8-10)16(17,18)19/h2-8H,1H3,(H2,20,21,22,23) |
| InChIKey | YRBCCSQYNZDYFU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |