C17H17N3O3S2 — CID 14578292
1-(5,6-dimethyl-1,3-benzothiazol-2-yl)-3-(2-methylphenyl)sulfonylurea (PubChem CID 14578292) has the molecular formula C17H17N3O3S2 and a molecular weight of 375.48 g/mol. Its IUPAC name is 1-(5,6-dimethyl-1,3-benzothiazol-2-yl)-3-(2-methylphenyl)sulfonylurea.
| Compound Name | 1-(5,6-dimethyl-1,3-benzothiazol-2-yl)-3-(2-methylphenyl)sulfonylurea |
|---|---|
| PubChem CID | 14578292 |
| Molecular Formula | C17H17N3O3S2 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 1-(5,6-dimethyl-1,3-benzothiazol-2-yl)-3-(2-methylphenyl)sulfonylurea |
| SMILES | Cc1cc2nc(NC(=O)NS(=O)(=O)c3ccccc3C)sc2cc1C |
| InChI | InChI=1S/C17H17N3O3S2/c1-10-6-4-5-7-15(10)25(22,23)20-16(21)19-17-18-13-8-11(2)12(3)9-14(13)24-17/h4-9H,1-3H3,(H2,18,19,20,21) |
| InChIKey | PXTJKGZYYBHCFF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |