C27H24N2OS — CID 58594241
(15S)-N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide (PubChem CID 58594241) has the molecular formula C27H24N2OS and a molecular weight of 424.57 g/mol. Its IUPAC name is (15S)-N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide.
| Compound Name | (15S)-N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 58594241 |
| Molecular Formula | C27H24N2OS |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | (15S)-N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
| SMILES | Cc1cc2nc(NC(=O)[C@@]3(C)CC4c5ccccc5C3c3ccccc34)sc2cc1C |
| InChI | InChI=1S/C27H24N2OS/c1-15-12-22-23(13-16(15)2)31-26(28-22)29-25(30)27(3)14-21-17-8-4-6-10-19(17)24(27)20-11-7-5-9-18(20)21/h4-13,21,24H,14H2,1-3H3,(H,28,29,30)/t21?,24?,27-/m0/s1 |
| InChIKey | RMJWCXNNCMRJEL-CGYPVTCASA-N |
| XLogP | 6.54 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |