C27H21IN2OS — CID 23596185
N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide (PubChem CID 23596185) has the molecular formula C27H21IN2OS and a molecular weight of 548.45 g/mol. Its IUPAC name is N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide.
| Compound Name | N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 23596185 |
| Molecular Formula | C27H21IN2OS |
| Molecular Weight | 548.45 g/mol |
| Exact Mass | 548.04 |
| IUPAC Name | N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
| SMILES | CC1(C(=O)Nc2nc(-c3ccc(I)cc3)cs2)CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C27H21IN2OS/c1-27(25(31)30-26-29-23(15-32-26)16-10-12-17(28)13-11-16)14-22-18-6-2-4-8-20(18)24(27)21-9-5-3-7-19(21)22/h2-13,15,22,24H,14H2,1H3,(H,29,30,31) |
| InChIKey | NDJDJACCLVWYJE-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.45 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|