C37H33N3O2S — CID 23596342
15-methyl-N-[4-[4-(2-phenylpropylcarbamoyl)phenyl]-1,3-thiazol-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide (PubChem CID 23596342) has the molecular formula C37H33N3O2S and a molecular weight of 583.76 g/mol. Its IUPAC name is 15-methyl-N-[4-[4-(2-phenylpropylcarbamoyl)phenyl]-1,3-thiazol-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide.
| Compound Name | 15-methyl-N-[4-[4-(2-phenylpropylcarbamoyl)phenyl]-1,3-thiazol-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 23596342 |
| Molecular Formula | C37H33N3O2S |
| Molecular Weight | 583.76 g/mol |
| Exact Mass | 583.23 |
| IUPAC Name | 15-methyl-N-[4-[4-(2-phenylpropylcarbamoyl)phenyl]-1,3-thiazol-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
| SMILES | CC(CNC(=O)c1ccc(-c2csc(NC(=O)C3(C)CC4c5ccccc5C3c3ccccc34)n2)cc1)c1ccccc1 |
| InChI | InChI=1S/C37H33N3O2S/c1-23(24-10-4-3-5-11-24)21-38-34(41)26-18-16-25(17-19-26)32-22-43-36(39-32)40-35(42)37(2)20-31-27-12-6-8-14-29(27)33(37)30-15-9-7-13-28(30)31/h3-19,22-23,31,33H,20-21H2,1-2H3,(H,38,41)(H,39,40,42) |
| InChIKey | DIODOHFOUWSSNN-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.76 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |