C35H28ClN3O2S — CID 23596115
N-[4-[3-[(4-chlorophenyl)methylcarbamoyl]phenyl]-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide (PubChem CID 23596115) has the molecular formula C35H28ClN3O2S and a molecular weight of 590.15 g/mol. Its IUPAC name is N-[4-[3-[(4-chlorophenyl)methylcarbamoyl]phenyl]-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide.
| Compound Name | N-[4-[3-[(4-chlorophenyl)methylcarbamoyl]phenyl]-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 23596115 |
| Molecular Formula | C35H28ClN3O2S |
| Molecular Weight | 590.15 g/mol |
| Exact Mass | 589.16 |
| IUPAC Name | N-[4-[3-[(4-chlorophenyl)methylcarbamoyl]phenyl]-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
| SMILES | CC1(C(=O)Nc2nc(-c3cccc(C(=O)NCc4ccc(Cl)cc4)c3)cs2)CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C35H28ClN3O2S/c1-35(18-29-25-9-2-4-11-27(25)31(35)28-12-5-3-10-26(28)29)33(41)39-34-38-30(20-42-34)22-7-6-8-23(17-22)32(40)37-19-21-13-15-24(36)16-14-21/h2-17,20,29,31H,18-19H2,1H3,(H,37,40)(H,38,39,41) |
| InChIKey | OWKFAQFHKADFJI-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.15 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |