C33H31N3O2S — CID 23596062
N-[4-[3-(cyclopentylcarbamoyl)phenyl]-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide (PubChem CID 23596062) has the molecular formula C33H31N3O2S and a molecular weight of 533.70 g/mol. Its IUPAC name is N-[4-[3-(cyclopentylcarbamoyl)phenyl]-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide.
| Compound Name | N-[4-[3-(cyclopentylcarbamoyl)phenyl]-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 23596062 |
| Molecular Formula | C33H31N3O2S |
| Molecular Weight | 533.70 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | N-[4-[3-(cyclopentylcarbamoyl)phenyl]-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
| SMILES | CC1(C(=O)Nc2nc(-c3cccc(C(=O)NC4CCCC4)c3)cs2)CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C33H31N3O2S/c1-33(18-27-23-13-4-6-15-25(23)29(33)26-16-7-5-14-24(26)27)31(38)36-32-35-28(19-39-32)20-9-8-10-21(17-20)30(37)34-22-11-2-3-12-22/h4-10,13-17,19,22,27,29H,2-3,11-12,18H2,1H3,(H,34,37)(H,35,36,38) |
| InChIKey | PFABYXSJJPMDKX-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.70 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |