C37H39N3O3S — CID 142854002
15-ethyl-N-[4-[3-[(4-methoxy-2-methylcyclohexyl)carbamoyl]phenyl]-1,3-thiazol-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide (PubChem CID 142854002) has the molecular formula C37H39N3O3S and a molecular weight of 605.80 g/mol. Its IUPAC name is 15-ethyl-N-[4-[3-[(4-methoxy-2-methylcyclohexyl)carbamoyl]phenyl]-1,3-thiazol-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide.
| Compound Name | 15-ethyl-N-[4-[3-[(4-methoxy-2-methylcyclohexyl)carbamoyl]phenyl]-1,3-thiazol-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 142854002 |
| Molecular Formula | C37H39N3O3S |
| Molecular Weight | 605.80 g/mol |
| Exact Mass | 605.27 |
| IUPAC Name | 15-ethyl-N-[4-[3-[(4-methoxy-2-methylcyclohexyl)carbamoyl]phenyl]-1,3-thiazol-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
| SMILES | CCC1(C(=O)Nc2nc(-c3cccc(C(=O)NC4CCC(OC)CC4C)c3)cs2)CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C37H39N3O3S/c1-4-37(20-30-26-12-5-7-14-28(26)33(37)29-15-8-6-13-27(29)30)35(42)40-36-39-32(21-44-36)23-10-9-11-24(19-23)34(41)38-31-17-16-25(43-3)18-22(31)2/h5-15,19,21-22,25,30-31,33H,4,16-18,20H2,1-3H3,(H,38,41)(H,39,40,42) |
| InChIKey | RISOSEZUWAKDCI-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.80 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |