C38H35N3O4S — CID 23596151
N-[4-[3-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl]phenyl]-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide (PubChem CID 23596151) has the molecular formula C38H35N3O4S and a molecular weight of 629.78 g/mol. Its IUPAC name is N-[4-[3-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl]phenyl]-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide.
| Compound Name | N-[4-[3-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl]phenyl]-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 23596151 |
| Molecular Formula | C38H35N3O4S |
| Molecular Weight | 629.78 g/mol |
| Exact Mass | 629.23 |
| IUPAC Name | N-[4-[3-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl]phenyl]-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
| SMILES | COc1ccc(CCNC(=O)c2cccc(-c3csc(NC(=O)C4(C)CC5c6ccccc6C4c4ccccc45)n3)c2)cc1OC |
| InChI | InChI=1S/C38H35N3O4S/c1-38(21-30-26-11-4-6-13-28(26)34(38)29-14-7-5-12-27(29)30)36(43)41-37-40-31(22-46-37)24-9-8-10-25(20-24)35(42)39-18-17-23-15-16-32(44-2)33(19-23)45-3/h4-16,19-20,22,30,34H,17-18,21H2,1-3H3,(H,39,42)(H,40,41,43) |
| InChIKey | RYIRQINFEGQDJN-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.78 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |