C33H29N5O2S — CID 23596159
N-[4-[4-[2-(1H-imidazol-5-yl)ethylcarbamoyl]phenyl]-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide (PubChem CID 23596159) has the molecular formula C33H29N5O2S and a molecular weight of 559.70 g/mol. Its IUPAC name is N-[4-[4-[2-(1H-imidazol-5-yl)ethylcarbamoyl]phenyl]-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide.
| Compound Name | N-[4-[4-[2-(1H-imidazol-5-yl)ethylcarbamoyl]phenyl]-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 23596159 |
| Molecular Formula | C33H29N5O2S |
| Molecular Weight | 559.70 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | N-[4-[4-[2-(1H-imidazol-5-yl)ethylcarbamoyl]phenyl]-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
| SMILES | CC1(C(=O)Nc2nc(-c3ccc(C(=O)NCCc4cnc[nH]4)cc3)cs2)CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C33H29N5O2S/c1-33(16-27-23-6-2-4-8-25(23)29(33)26-9-5-3-7-24(26)27)31(40)38-32-37-28(18-41-32)20-10-12-21(13-11-20)30(39)35-15-14-22-17-34-19-36-22/h2-13,17-19,27,29H,14-16H2,1H3,(H,34,36)(H,35,39)(H,37,38,40) |
| InChIKey | CSJIPWGOJPUIIM-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.70 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |