C35H29N3O2S — CID 23596107
N-[4-[3-(benzylcarbamoyl)phenyl]-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide (PubChem CID 23596107) has the molecular formula C35H29N3O2S and a molecular weight of 555.70 g/mol. Its IUPAC name is N-[4-[3-(benzylcarbamoyl)phenyl]-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide.
| Compound Name | N-[4-[3-(benzylcarbamoyl)phenyl]-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 23596107 |
| Molecular Formula | C35H29N3O2S |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | N-[4-[3-(benzylcarbamoyl)phenyl]-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
| SMILES | CC1(C(=O)Nc2nc(-c3cccc(C(=O)NCc4ccccc4)c3)cs2)CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C35H29N3O2S/c1-35(19-29-25-14-5-7-16-27(25)31(35)28-17-8-6-15-26(28)29)33(40)38-34-37-30(21-41-34)23-12-9-13-24(18-23)32(39)36-20-22-10-3-2-4-11-22/h2-18,21,29,31H,19-20H2,1H3,(H,36,39)(H,37,38,40) |
| InChIKey | OERKVAXUUBYFJO-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |