C34H25Cl2N3O2S — CID 23596077
N-[4-[3-[(2,5-dichlorophenyl)carbamoyl]phenyl]-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide (PubChem CID 23596077) has the molecular formula C34H25Cl2N3O2S and a molecular weight of 610.57 g/mol. Its IUPAC name is N-[4-[3-[(2,5-dichlorophenyl)carbamoyl]phenyl]-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide.
| Compound Name | N-[4-[3-[(2,5-dichlorophenyl)carbamoyl]phenyl]-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 23596077 |
| Molecular Formula | C34H25Cl2N3O2S |
| Molecular Weight | 610.57 g/mol |
| Exact Mass | 609.10 |
| IUPAC Name | N-[4-[3-[(2,5-dichlorophenyl)carbamoyl]phenyl]-1,3-thiazol-2-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
| SMILES | CC1(C(=O)Nc2nc(-c3cccc(C(=O)Nc4cc(Cl)ccc4Cl)c3)cs2)CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C34H25Cl2N3O2S/c1-34(17-26-22-9-2-4-11-24(22)30(34)25-12-5-3-10-23(25)26)32(41)39-33-38-29(18-42-33)19-7-6-8-20(15-19)31(40)37-28-16-21(35)13-14-27(28)36/h2-16,18,26,30H,17H2,1H3,(H,37,40)(H,38,39,41) |
| InChIKey | JLWSXCHNBCVVSE-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.57 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |