C34H28N4O3S — CID 23596193
N-(3-methoxyphenyl)-6-[2-[(15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)amino]-1,3-thiazol-4-yl]pyridine-2-carboxamide (PubChem CID 23596193) has the molecular formula C34H28N4O3S and a molecular weight of 572.69 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-6-[2-[(15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)amino]-1,3-thiazol-4-yl]pyridine-2-carboxamide.
| Compound Name | N-(3-methoxyphenyl)-6-[2-[(15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)amino]-1,3-thiazol-4-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 23596193 |
| Molecular Formula | C34H28N4O3S |
| Molecular Weight | 572.69 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | N-(3-methoxyphenyl)-6-[2-[(15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl)amino]-1,3-thiazol-4-yl]pyridine-2-carboxamide |
| SMILES | COc1cccc(NC(=O)c2cccc(-c3csc(NC(=O)C4(C)CC5c6ccccc6C4c4ccccc45)n3)n2)c1 |
| InChI | InChI=1S/C34H28N4O3S/c1-34(18-26-22-11-3-5-13-24(22)30(34)25-14-6-4-12-23(25)26)32(40)38-33-37-29(19-42-33)27-15-8-16-28(36-27)31(39)35-20-9-7-10-21(17-20)41-2/h3-17,19,26,30H,18H2,1-2H3,(H,35,39)(H,37,38,40) |
| InChIKey | FHDDGACINUFTGH-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.69 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |