C26H25NO3 — CID 1298429
(15R)-N-(2,4-dimethoxyphenyl)-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide (PubChem CID 1298429) has the molecular formula C26H25NO3 and a molecular weight of 399.49 g/mol. Its IUPAC name is (15R)-N-(2,4-dimethoxyphenyl)-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide.
| Compound Name | (15R)-N-(2,4-dimethoxyphenyl)-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 1298429 |
| Molecular Formula | C26H25NO3 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | (15R)-N-(2,4-dimethoxyphenyl)-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@]2(C)CC3c4ccccc4C2c2ccccc23)c(OC)c1 |
| InChI | InChI=1S/C26H25NO3/c1-26(25(28)27-22-13-12-16(29-2)14-23(22)30-3)15-21-17-8-4-6-10-19(17)24(26)20-11-7-5-9-18(20)21/h4-14,21,24H,15H2,1-3H3,(H,27,28)/t21?,24?,26-/m1/s1 |
| InChIKey | UPHGGEIIAQAKNA-XAZLJPHMSA-N |
| XLogP | 5.33 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |