C34H33N3O2S — CID 142854082
15-ethyl-N-[4-[3-(piperidine-1-carbonyl)phenyl]-1,3-thiazol-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide (PubChem CID 142854082) has the molecular formula C34H33N3O2S and a molecular weight of 547.72 g/mol. Its IUPAC name is 15-ethyl-N-[4-[3-(piperidine-1-carbonyl)phenyl]-1,3-thiazol-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide.
| Compound Name | 15-ethyl-N-[4-[3-(piperidine-1-carbonyl)phenyl]-1,3-thiazol-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 142854082 |
| Molecular Formula | C34H33N3O2S |
| Molecular Weight | 547.72 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | 15-ethyl-N-[4-[3-(piperidine-1-carbonyl)phenyl]-1,3-thiazol-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
| SMILES | CCC1(C(=O)Nc2nc(-c3cccc(C(=O)N4CCCCC4)c3)cs2)CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C34H33N3O2S/c1-2-34(20-28-24-13-4-6-15-26(24)30(34)27-16-7-5-14-25(27)28)32(39)36-33-35-29(21-40-33)22-11-10-12-23(19-22)31(38)37-17-8-3-9-18-37/h4-7,10-16,19,21,28,30H,2-3,8-9,17-18,20H2,1H3,(H,35,36,39) |
| InChIKey | UNGSGTWXLSBUOK-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.72 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |