C25H22N2O3 — CID 1041608
(15S)-15-methyl-N-(2-methyl-5-nitrophenyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide (PubChem CID 1041608) has the molecular formula C25H22N2O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is (15S)-15-methyl-N-(2-methyl-5-nitrophenyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide.
| Compound Name | (15S)-15-methyl-N-(2-methyl-5-nitrophenyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 1041608 |
| Molecular Formula | C25H22N2O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | (15S)-15-methyl-N-(2-methyl-5-nitrophenyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)[C@@]1(C)CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C25H22N2O3/c1-15-11-12-16(27(29)30)13-22(15)26-24(28)25(2)14-21-17-7-3-5-9-19(17)23(25)20-10-6-4-8-18(20)21/h3-13,21,23H,14H2,1-2H3,(H,26,28)/t21?,23?,25-/m0/s1 |
| InChIKey | BNLGQOBZYBKGHG-GCKKQHTFSA-N |
| XLogP | 5.53 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|