C14H12N2OS2 — CID 7524846
N-(5,6-dimethyl-1,3-benzothiazol-2-yl)thiophene-2-carboxamide (PubChem CID 7524846) has the molecular formula C14H12N2OS2 and a molecular weight of 288.40 g/mol. Its IUPAC name is N-(5,6-dimethyl-1,3-benzothiazol-2-yl)thiophene-2-carboxamide.
| Compound Name | N-(5,6-dimethyl-1,3-benzothiazol-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 7524846 |
| Molecular Formula | C14H12N2OS2 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | N-(5,6-dimethyl-1,3-benzothiazol-2-yl)thiophene-2-carboxamide |
| SMILES | Cc1cc2nc(NC(=O)c3cccs3)sc2cc1C |
| InChI | InChI=1S/C14H12N2OS2/c1-8-6-10-12(7-9(8)2)19-14(15-10)16-13(17)11-4-3-5-18-11/h3-7H,1-2H3,(H,15,16,17) |
| InChIKey | GMZHCACVLCCUNJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |