C19H13N5O2S5 — CID 17273939
N-[[2-(thiophene-2-carbonylcarbamothioylamino)-1,3-benzothiazol-6-yl]carbamothioyl]thiophene-2-carboxamide (PubChem CID 17273939) has the molecular formula C19H13N5O2S5 and a molecular weight of 503.68 g/mol. Its IUPAC name is N-[[2-(thiophene-2-carbonylcarbamothioylamino)-1,3-benzothiazol-6-yl]carbamothioyl]thiophene-2-carboxamide.
| Compound Name | N-[[2-(thiophene-2-carbonylcarbamothioylamino)-1,3-benzothiazol-6-yl]carbamothioyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 17273939 |
| Molecular Formula | C19H13N5O2S5 |
| Molecular Weight | 503.68 g/mol |
| Exact Mass | 502.97 |
| IUPAC Name | N-[[2-(thiophene-2-carbonylcarbamothioylamino)-1,3-benzothiazol-6-yl]carbamothioyl]thiophene-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc2nc(NC(=S)NC(=O)c3cccs3)sc2c1)c1cccs1 |
| InChI | InChI=1S/C19H13N5O2S5/c25-15(12-3-1-7-29-12)22-17(27)20-10-5-6-11-14(9-10)31-19(21-11)24-18(28)23-16(26)13-4-2-8-30-13/h1-9H,(H2,20,22,25,27)(H2,21,23,24,26,28) |
| InChIKey | PNINIZHLLOAHKU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.68 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|