C15H13N3OS3 — CID 17100360
N-[(4,7-dimethyl-1,3-benzothiazol-2-yl)carbamothioyl]thiophene-2-carboxamide (PubChem CID 17100360) has the molecular formula C15H13N3OS3 and a molecular weight of 347.49 g/mol. Its IUPAC name is N-[(4,7-dimethyl-1,3-benzothiazol-2-yl)carbamothioyl]thiophene-2-carboxamide.
| Compound Name | N-[(4,7-dimethyl-1,3-benzothiazol-2-yl)carbamothioyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 17100360 |
| Molecular Formula | C15H13N3OS3 |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | N-[(4,7-dimethyl-1,3-benzothiazol-2-yl)carbamothioyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(C)c2sc(NC(=S)NC(=O)c3cccs3)nc12 |
| InChI | InChI=1S/C15H13N3OS3/c1-8-5-6-9(2)12-11(8)16-15(22-12)18-14(20)17-13(19)10-4-3-7-21-10/h3-7H,1-2H3,(H2,16,17,18,19,20) |
| InChIKey | VACXZZAGXNPHFG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|