C17H14FN3OS2 — CID 17100359
N-[(4,7-dimethyl-1,3-benzothiazol-2-yl)carbamothioyl]-3-fluorobenzamide (PubChem CID 17100359) has the molecular formula C17H14FN3OS2 and a molecular weight of 359.45 g/mol. Its IUPAC name is N-[(4,7-dimethyl-1,3-benzothiazol-2-yl)carbamothioyl]-3-fluorobenzamide.
| Compound Name | N-[(4,7-dimethyl-1,3-benzothiazol-2-yl)carbamothioyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 17100359 |
| Molecular Formula | C17H14FN3OS2 |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | N-[(4,7-dimethyl-1,3-benzothiazol-2-yl)carbamothioyl]-3-fluorobenzamide |
| SMILES | Cc1ccc(C)c2sc(NC(=S)NC(=O)c3cccc(F)c3)nc12 |
| InChI | InChI=1S/C17H14FN3OS2/c1-9-6-7-10(2)14-13(9)19-17(24-14)21-16(23)20-15(22)11-4-3-5-12(18)8-11/h3-8H,1-2H3,(H2,19,20,21,22,23) |
| InChIKey | RIIRNGKTJBNDSA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|