C30H26N4O2S2 — CID 159176709
N-(4-methyl-1,3-benzothiazol-2-yl)benzamide;N-[(2-methylphenyl)carbamothioyl]benzamide (PubChem CID 159176709) has the molecular formula C30H26N4O2S2 and a molecular weight of 538.70 g/mol. Its IUPAC name is N-(4-methyl-1,3-benzothiazol-2-yl)benzamide;N-[(2-methylphenyl)carbamothioyl]benzamide.
| Compound Name | N-(4-methyl-1,3-benzothiazol-2-yl)benzamide;N-[(2-methylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 159176709 |
| Molecular Formula | C30H26N4O2S2 |
| Molecular Weight | 538.70 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | N-(4-methyl-1,3-benzothiazol-2-yl)benzamide;N-[(2-methylphenyl)carbamothioyl]benzamide |
| SMILES | Cc1cccc2sc(NC(=O)c3ccccc3)nc12.Cc1ccccc1NC(=S)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H12N2OS.C15H14N2OS/c1-10-6-5-9-12-13(10)16-15(19-12)17-14(18)11-7-3-2-4-8-11;1-11-7-5-6-10-13(11)16-15(19)17-14(18)12-8-3-2-4-9-12/h2-9H,1H3,(H,16,17,18);2-10H,1H3,(H2,16,17,18,19) |
| InChIKey | KMJHGCHVVBIVIJ-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.70 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|