C15H9Cl2N3OS2 — CID 4642924
3-chloro-N-[(4-chloro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide (PubChem CID 4642924) has the molecular formula C15H9Cl2N3OS2 and a molecular weight of 382.30 g/mol. Its IUPAC name is 3-chloro-N-[(4-chloro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide.
| Compound Name | 3-chloro-N-[(4-chloro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4642924 |
| Molecular Formula | C15H9Cl2N3OS2 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 380.96 |
| IUPAC Name | 3-chloro-N-[(4-chloro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1nc2c(Cl)cccc2s1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H9Cl2N3OS2/c16-9-4-1-3-8(7-9)13(21)19-14(22)20-15-18-12-10(17)5-2-6-11(12)23-15/h1-7H,(H2,18,19,20,21,22) |
| InChIKey | XTDVRNWIOXQRGP-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|