C17H14ClN3O2S2 — CID 4213163
N-[(4-chloro-1,3-benzothiazol-2-yl)carbamothioyl]-2-methoxy-3-methylbenzamide (PubChem CID 4213163) has the molecular formula C17H14ClN3O2S2 and a molecular weight of 391.91 g/mol. Its IUPAC name is N-[(4-chloro-1,3-benzothiazol-2-yl)carbamothioyl]-2-methoxy-3-methylbenzamide.
| Compound Name | N-[(4-chloro-1,3-benzothiazol-2-yl)carbamothioyl]-2-methoxy-3-methylbenzamide |
|---|---|
| PubChem CID | 4213163 |
| Molecular Formula | C17H14ClN3O2S2 |
| Molecular Weight | 391.91 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | N-[(4-chloro-1,3-benzothiazol-2-yl)carbamothioyl]-2-methoxy-3-methylbenzamide |
| SMILES | COc1c(C)cccc1C(=O)NC(=S)Nc1nc2c(Cl)cccc2s1 |
| InChI | InChI=1S/C17H14ClN3O2S2/c1-9-5-3-6-10(14(9)23-2)15(22)20-16(24)21-17-19-13-11(18)7-4-8-12(13)25-17/h3-8H,1-2H3,(H2,19,20,21,22,24) |
| InChIKey | IJOCNFQJRQTOQA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.91 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|