C16H13ClN4O2S2 — CID 17099297
N-[(5-chloro-2,1,3-benzothiadiazol-4-yl)carbamothioyl]-2-methoxy-3-methylbenzamide (PubChem CID 17099297) has the molecular formula C16H13ClN4O2S2 and a molecular weight of 392.89 g/mol. Its IUPAC name is N-[(5-chloro-2,1,3-benzothiadiazol-4-yl)carbamothioyl]-2-methoxy-3-methylbenzamide.
| Compound Name | N-[(5-chloro-2,1,3-benzothiadiazol-4-yl)carbamothioyl]-2-methoxy-3-methylbenzamide |
|---|---|
| PubChem CID | 17099297 |
| Molecular Formula | C16H13ClN4O2S2 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | N-[(5-chloro-2,1,3-benzothiadiazol-4-yl)carbamothioyl]-2-methoxy-3-methylbenzamide |
| SMILES | COc1c(C)cccc1C(=O)NC(=S)Nc1c(Cl)ccc2nsnc12 |
| InChI | InChI=1S/C16H13ClN4O2S2/c1-8-4-3-5-9(14(8)23-2)15(22)19-16(24)18-12-10(17)6-7-11-13(12)21-25-20-11/h3-7H,1-2H3,(H2,18,19,22,24) |
| InChIKey | DBARADIDXRCUQY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|