C17H14ClN3OS2 — CID 3960818
N-[(4-chloro-1,3-benzothiazol-2-yl)carbamothioyl]-4-ethylbenzamide (PubChem CID 3960818) has the molecular formula C17H14ClN3OS2 and a molecular weight of 375.91 g/mol. Its IUPAC name is N-[(4-chloro-1,3-benzothiazol-2-yl)carbamothioyl]-4-ethylbenzamide.
| Compound Name | N-[(4-chloro-1,3-benzothiazol-2-yl)carbamothioyl]-4-ethylbenzamide |
|---|---|
| PubChem CID | 3960818 |
| Molecular Formula | C17H14ClN3OS2 |
| Molecular Weight | 375.91 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | N-[(4-chloro-1,3-benzothiazol-2-yl)carbamothioyl]-4-ethylbenzamide |
| SMILES | CCc1ccc(C(=O)NC(=S)Nc2nc3c(Cl)cccc3s2)cc1 |
| InChI | InChI=1S/C17H14ClN3OS2/c1-2-10-6-8-11(9-7-10)15(22)20-16(23)21-17-19-14-12(18)4-3-5-13(14)24-17/h3-9H,2H2,1H3,(H2,19,20,21,22,23) |
| InChIKey | WSEOOXQDVBOSPS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.91 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|