C20H15N3OS3 — CID 54859155
N-[[4-(1,3-benzothiazol-2-ylmethyl)phenyl]carbamothioyl]thiophene-2-carboxamide (PubChem CID 54859155) has the molecular formula C20H15N3OS3 and a molecular weight of 409.56 g/mol. Its IUPAC name is N-[[4-(1,3-benzothiazol-2-ylmethyl)phenyl]carbamothioyl]thiophene-2-carboxamide.
| Compound Name | N-[[4-(1,3-benzothiazol-2-ylmethyl)phenyl]carbamothioyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 54859155 |
| Molecular Formula | C20H15N3OS3 |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | N-[[4-(1,3-benzothiazol-2-ylmethyl)phenyl]carbamothioyl]thiophene-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(Cc2nc3ccccc3s2)cc1)c1cccs1 |
| InChI | InChI=1S/C20H15N3OS3/c24-19(17-6-3-11-26-17)23-20(25)21-14-9-7-13(8-10-14)12-18-22-15-4-1-2-5-16(15)27-18/h1-11H,12H2,(H2,21,23,24,25) |
| InChIKey | FNNIFDGAHOGIBD-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|