C22H19N3S2 — CID 8628473
1-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-3-benzylthiourea (PubChem CID 8628473) has the molecular formula C22H19N3S2 and a molecular weight of 389.55 g/mol. Its IUPAC name is 1-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-3-benzylthiourea.
| Compound Name | 1-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-3-benzylthiourea |
|---|---|
| PubChem CID | 8628473 |
| Molecular Formula | C22H19N3S2 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 1-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-3-benzylthiourea |
| SMILES | S=C(NCc1ccccc1)Nc1ccc(Cc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C22H19N3S2/c26-22(23-15-17-6-2-1-3-7-17)24-18-12-10-16(11-13-18)14-21-25-19-8-4-5-9-20(19)27-21/h1-13H,14-15H2,(H2,23,24,26) |
| InChIKey | TWHJBOKIEBEUKY-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|