C20H16N2O2S2 — CID 8004145
N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]benzenesulfonamide (PubChem CID 8004145) has the molecular formula C20H16N2O2S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]benzenesulfonamide.
| Compound Name | N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 8004145 |
| Molecular Formula | C20H16N2O2S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Cc2nc3ccccc3s2)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H16N2O2S2/c23-26(24,17-6-2-1-3-7-17)22-16-12-10-15(11-13-16)14-20-21-18-8-4-5-9-19(18)25-20/h1-13,22H,14H2 |
| InChIKey | DDRAOVYDCJMWFL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |