C20H15ClN2O2S2 — CID 7938840
N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-4-chlorobenzenesulfonamide (PubChem CID 7938840) has the molecular formula C20H15ClN2O2S2 and a molecular weight of 414.94 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-4-chlorobenzenesulfonamide.
| Compound Name | N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 7938840 |
| Molecular Formula | C20H15ClN2O2S2 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-ylmethyl)phenyl]-4-chlorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Cc2nc3ccccc3s2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H15ClN2O2S2/c21-15-7-11-17(12-8-15)27(24,25)23-16-9-5-14(6-10-16)13-20-22-18-3-1-2-4-19(18)26-20/h1-12,23H,13H2 |
| InChIKey | HJRFHJZVOXWYBH-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |