C19H13ClN2O2S2 — CID 1255601
N-[3-(1,3-benzothiazol-2-yl)phenyl]-4-chlorobenzenesulfonamide (PubChem CID 1255601) has the molecular formula C19H13ClN2O2S2 and a molecular weight of 400.91 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)phenyl]-4-chlorobenzenesulfonamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 1255601 |
| Molecular Formula | C19H13ClN2O2S2 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-4-chlorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(-c2nc3ccccc3s2)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H13ClN2O2S2/c20-14-8-10-16(11-9-14)26(23,24)22-15-5-3-4-13(12-15)19-21-17-6-1-2-7-18(17)25-19/h1-12,22H |
| InChIKey | AOZLXUGICVBUAE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |