C26H18ClN3O3S2 — CID 121041109
N-[2-(1,3-benzothiazol-2-yl)phenyl]-2-[(4-chlorophenyl)sulfonylamino]benzamide (PubChem CID 121041109) has the molecular formula C26H18ClN3O3S2 and a molecular weight of 520.04 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)phenyl]-2-[(4-chlorophenyl)sulfonylamino]benzamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)phenyl]-2-[(4-chlorophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 121041109 |
| Molecular Formula | C26H18ClN3O3S2 |
| Molecular Weight | 520.04 g/mol |
| Exact Mass | 519.05 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)phenyl]-2-[(4-chlorophenyl)sulfonylamino]benzamide |
| SMILES | O=C(Nc1ccccc1-c1nc2ccccc2s1)c1ccccc1NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H18ClN3O3S2/c27-17-13-15-18(16-14-17)35(32,33)30-22-10-4-1-7-19(22)25(31)28-21-9-3-2-8-20(21)26-29-23-11-5-6-12-24(23)34-26/h1-16,30H,(H,28,31) |
| InChIKey | PISMWAUGOLAIGP-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.04 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |