C20H13ClN3O3S2- — CID 2331914
N-(1,3-benzothiazol-2-yl)-2-[(4-chlorophenyl)sulfonylamino]benzenecarboximidate (PubChem CID 2331914) has the molecular formula C20H13ClN3O3S2- and a molecular weight of 442.93 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-[(4-chlorophenyl)sulfonylamino]benzenecarboximidate.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-[(4-chlorophenyl)sulfonylamino]benzenecarboximidate |
|---|---|
| PubChem CID | 2331914 |
| Molecular Formula | C20H13ClN3O3S2- |
| Molecular Weight | 442.93 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-[(4-chlorophenyl)sulfonylamino]benzenecarboximidate |
| SMILES | O=S(=O)(Nc1ccccc1C([O-])=Nc1nc2ccccc2s1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H14ClN3O3S2/c21-13-9-11-14(12-10-13)29(26,27)24-16-6-2-1-5-15(16)19(25)23-20-22-17-7-3-4-8-18(17)28-20/h1-12,24H,(H,22,23,25)/p-1 |
| InChIKey | GPCTXLDLONDKSA-UHFFFAOYSA-M |
| XLogP | 4.19 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.93 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|