C21H14F2N3O4S2- — CID 2374729
2-[(3,4-difluorophenyl)sulfonylamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)benzenecarboximidate (PubChem CID 2374729) has the molecular formula C21H14F2N3O4S2- and a molecular weight of 474.49 g/mol. Its IUPAC name is 2-[(3,4-difluorophenyl)sulfonylamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)benzenecarboximidate.
| Compound Name | 2-[(3,4-difluorophenyl)sulfonylamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)benzenecarboximidate |
|---|---|
| PubChem CID | 2374729 |
| Molecular Formula | C21H14F2N3O4S2- |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | 2-[(3,4-difluorophenyl)sulfonylamino]-N-(6-methoxy-1,3-benzothiazol-2-yl)benzenecarboximidate |
| SMILES | COc1ccc2nc(N=C([O-])c3ccccc3NS(=O)(=O)c3ccc(F)c(F)c3)sc2c1 |
| InChI | InChI=1S/C21H15F2N3O4S2/c1-30-12-6-9-18-19(10-12)31-21(24-18)25-20(27)14-4-2-3-5-17(14)26-32(28,29)13-7-8-15(22)16(23)11-13/h2-11,26H,1H3,(H,24,25,27)/p-1 |
| InChIKey | DUTLMQBIXDNXGV-UHFFFAOYSA-M |
| XLogP | 3.82 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|