C27H19F2NO5S — CID 25039219
(2-oxo-1,2-diphenylethyl) 2-[(3,4-difluorophenyl)sulfonylamino]benzoate (PubChem CID 25039219) has the molecular formula C27H19F2NO5S and a molecular weight of 507.51 g/mol. Its IUPAC name is (2-oxo-1,2-diphenylethyl) 2-[(3,4-difluorophenyl)sulfonylamino]benzoate.
| Compound Name | (2-oxo-1,2-diphenylethyl) 2-[(3,4-difluorophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 25039219 |
| Molecular Formula | C27H19F2NO5S |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 507.10 |
| IUPAC Name | (2-oxo-1,2-diphenylethyl) 2-[(3,4-difluorophenyl)sulfonylamino]benzoate |
| SMILES | O=C(OC(C(=O)c1ccccc1)c1ccccc1)c1ccccc1NS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C27H19F2NO5S/c28-22-16-15-20(17-23(22)29)36(33,34)30-24-14-8-7-13-21(24)27(32)35-26(19-11-5-2-6-12-19)25(31)18-9-3-1-4-10-18/h1-17,26,30H |
| InChIKey | ISGDFAMGKDTKPH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |