C13H11F2NO4S — CID 102695953
3,4-difluoro-N-(2-hydroxy-4-methoxyphenyl)benzenesulfonamide (PubChem CID 102695953) has the molecular formula C13H11F2NO4S and a molecular weight of 315.30 g/mol. Its IUPAC name is 3,4-difluoro-N-(2-hydroxy-4-methoxyphenyl)benzenesulfonamide.
| Compound Name | 3,4-difluoro-N-(2-hydroxy-4-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 102695953 |
| Molecular Formula | C13H11F2NO4S |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 3,4-difluoro-N-(2-hydroxy-4-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(F)c(F)c2)c(O)c1 |
| InChI | InChI=1S/C13H11F2NO4S/c1-20-8-2-5-12(13(17)6-8)16-21(18,19)9-3-4-10(14)11(15)7-9/h2-7,16-17H,1H3 |
| InChIKey | HGMOWLVKDSJPJJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|