C10H11N3O4S — CID 102695858
N-(2-hydroxy-4-methoxyphenyl)-1H-imidazole-5-sulfonamide (PubChem CID 102695858) has the molecular formula C10H11N3O4S and a molecular weight of 269.28 g/mol. Its IUPAC name is N-(2-hydroxy-4-methoxyphenyl)-1H-imidazole-5-sulfonamide.
| Compound Name | N-(2-hydroxy-4-methoxyphenyl)-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 102695858 |
| Molecular Formula | C10H11N3O4S |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | N-(2-hydroxy-4-methoxyphenyl)-1H-imidazole-5-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cnc[nH]2)c(O)c1 |
| InChI | InChI=1S/C10H11N3O4S/c1-17-7-2-3-8(9(14)4-7)13-18(15,16)10-5-11-6-12-10/h2-6,13-14H,1H3,(H,11,12) |
| InChIKey | XYENDQKNDOXEMZ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|