C12H17NO6S — CID 102695904
methyl 4-[(2-hydroxy-4-methoxyphenyl)sulfamoyl]butanoate (PubChem CID 102695904) has the molecular formula C12H17NO6S and a molecular weight of 303.34 g/mol. Its IUPAC name is methyl 4-[(2-hydroxy-4-methoxyphenyl)sulfamoyl]butanoate.
| Compound Name | methyl 4-[(2-hydroxy-4-methoxyphenyl)sulfamoyl]butanoate |
|---|---|
| PubChem CID | 102695904 |
| Molecular Formula | C12H17NO6S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | methyl 4-[(2-hydroxy-4-methoxyphenyl)sulfamoyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)Nc1ccc(OC)cc1O |
| InChI | InChI=1S/C12H17NO6S/c1-18-9-5-6-10(11(14)8-9)13-20(16,17)7-3-4-12(15)19-2/h5-6,8,13-14H,3-4,7H2,1-2H3 |
| InChIKey | KZOVMEGDXCWCNY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|