C12H17NO4S2 — CID 61460153
methyl 4-[(2-methylsulfanylphenyl)sulfamoyl]butanoate (PubChem CID 61460153) has the molecular formula C12H17NO4S2 and a molecular weight of 303.41 g/mol. Its IUPAC name is methyl 4-[(2-methylsulfanylphenyl)sulfamoyl]butanoate.
| Compound Name | methyl 4-[(2-methylsulfanylphenyl)sulfamoyl]butanoate |
|---|---|
| PubChem CID | 61460153 |
| Molecular Formula | C12H17NO4S2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | methyl 4-[(2-methylsulfanylphenyl)sulfamoyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)Nc1ccccc1SC |
| InChI | InChI=1S/C12H17NO4S2/c1-17-12(14)8-5-9-19(15,16)13-10-6-3-4-7-11(10)18-2/h3-4,6-7,13H,5,8-9H2,1-2H3 |
| InChIKey | XQSKCMJEVNSASA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |