C12H14FNO6S — CID 61457587
2-fluoro-6-[(4-methoxy-4-oxobutyl)sulfonylamino]benzoic acid (PubChem CID 61457587) has the molecular formula C12H14FNO6S and a molecular weight of 319.31 g/mol. Its IUPAC name is 2-fluoro-6-[(4-methoxy-4-oxobutyl)sulfonylamino]benzoic acid.
| Compound Name | 2-fluoro-6-[(4-methoxy-4-oxobutyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 61457587 |
| Molecular Formula | C12H14FNO6S |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 2-fluoro-6-[(4-methoxy-4-oxobutyl)sulfonylamino]benzoic acid |
| SMILES | COC(=O)CCCS(=O)(=O)Nc1cccc(F)c1C(=O)O |
| InChI | InChI=1S/C12H14FNO6S/c1-20-10(15)6-3-7-21(18,19)14-9-5-2-4-8(13)11(9)12(16)17/h2,4-5,14H,3,6-7H2,1H3,(H,16,17) |
| InChIKey | WQJZLTZNWOREHP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |