C11H14N2O6S — CID 63643110
6-[(4-methoxy-4-oxobutyl)sulfonylamino]pyridine-2-carboxylic acid (PubChem CID 63643110) has the molecular formula C11H14N2O6S and a molecular weight of 302.31 g/mol. Its IUPAC name is 6-[(4-methoxy-4-oxobutyl)sulfonylamino]pyridine-2-carboxylic acid.
| Compound Name | 6-[(4-methoxy-4-oxobutyl)sulfonylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 63643110 |
| Molecular Formula | C11H14N2O6S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 6-[(4-methoxy-4-oxobutyl)sulfonylamino]pyridine-2-carboxylic acid |
| SMILES | COC(=O)CCCS(=O)(=O)Nc1cccc(C(=O)O)n1 |
| InChI | InChI=1S/C11H14N2O6S/c1-19-10(14)6-3-7-20(17,18)13-9-5-2-4-8(12-9)11(15)16/h2,4-5H,3,6-7H2,1H3,(H,12,13)(H,15,16) |
| InChIKey | OVKXAYVHASFSKG-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 122.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |