C11H16N2O4S — CID 54952273
methyl 4-[(3-methyl-2-pyridinyl)sulfamoyl]butanoate (PubChem CID 54952273) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is methyl 4-[(3-methyl-2-pyridinyl)sulfamoyl]butanoate.
| Compound Name | methyl 4-[(3-methyl-2-pyridinyl)sulfamoyl]butanoate |
|---|---|
| PubChem CID | 54952273 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | methyl 4-[(3-methyl-2-pyridinyl)sulfamoyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)Nc1ncccc1C |
| InChI | InChI=1S/C11H16N2O4S/c1-9-5-3-7-12-11(9)13-18(15,16)8-4-6-10(14)17-2/h3,5,7H,4,6,8H2,1-2H3,(H,12,13) |
| InChIKey | MNBJVFYJRHCVRX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |