C11H15BrN2O4S — CID 79734705
methyl 4-[(5-bromo-4-methyl-2-pyridinyl)sulfamoyl]butanoate (PubChem CID 79734705) has the molecular formula C11H15BrN2O4S and a molecular weight of 351.22 g/mol. Its IUPAC name is methyl 4-[(5-bromo-4-methyl-2-pyridinyl)sulfamoyl]butanoate.
| Compound Name | methyl 4-[(5-bromo-4-methyl-2-pyridinyl)sulfamoyl]butanoate |
|---|---|
| PubChem CID | 79734705 |
| Molecular Formula | C11H15BrN2O4S |
| Molecular Weight | 351.22 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | methyl 4-[(5-bromo-4-methyl-2-pyridinyl)sulfamoyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)Nc1cc(C)c(Br)cn1 |
| InChI | InChI=1S/C11H15BrN2O4S/c1-8-6-10(13-7-9(8)12)14-19(16,17)5-3-4-11(15)18-2/h6-7H,3-5H2,1-2H3,(H,13,14) |
| InChIKey | PBKVFWWRRUDBKL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.22 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |