C8H11BrN2O3S — CID 79729788
N-(5-bromo-4-methyl-2-pyridinyl)-2-hydroxyethanesulfonamide (PubChem CID 79729788) has the molecular formula C8H11BrN2O3S and a molecular weight of 295.16 g/mol. Its IUPAC name is N-(5-bromo-4-methyl-2-pyridinyl)-2-hydroxyethanesulfonamide.
| Compound Name | N-(5-bromo-4-methyl-2-pyridinyl)-2-hydroxyethanesulfonamide |
|---|---|
| PubChem CID | 79729788 |
| Molecular Formula | C8H11BrN2O3S |
| Molecular Weight | 295.16 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | N-(5-bromo-4-methyl-2-pyridinyl)-2-hydroxyethanesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)CCO)ncc1Br |
| InChI | InChI=1S/C8H11BrN2O3S/c1-6-4-8(10-5-7(6)9)11-15(13,14)3-2-12/h4-5,12H,2-3H2,1H3,(H,10,11) |
| InChIKey | GQFKGBUQIKOBJC-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.16 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |