C9H13BrN2O — CID 53409461
3-[(5-bromo-4-methyl-2-pyridinyl)amino]propan-1-ol (PubChem CID 53409461) has the molecular formula C9H13BrN2O and a molecular weight of 245.12 g/mol. Its IUPAC name is 3-[(5-bromo-4-methyl-2-pyridinyl)amino]propan-1-ol.
| Compound Name | 3-[(5-bromo-4-methyl-2-pyridinyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 53409461 |
| Molecular Formula | C9H13BrN2O |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 3-[(5-bromo-4-methyl-2-pyridinyl)amino]propan-1-ol |
| SMILES | Cc1cc(NCCCO)ncc1Br |
| InChI | InChI=1S/C9H13BrN2O/c1-7-5-9(11-3-2-4-13)12-6-8(7)10/h5-6,13H,2-4H2,1H3,(H,11,12) |
| InChIKey | LBOSPYQIUZFLMH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|