C10H12BrF3N2 — CID 115774199
5-bromo-4-methyl-N-(4,4,4-trifluorobutyl)pyridin-2-amine (PubChem CID 115774199) has the molecular formula C10H12BrF3N2 and a molecular weight of 297.12 g/mol. Its IUPAC name is 5-bromo-4-methyl-N-(4,4,4-trifluorobutyl)pyridin-2-amine.
| Compound Name | 5-bromo-4-methyl-N-(4,4,4-trifluorobutyl)pyridin-2-amine |
|---|---|
| PubChem CID | 115774199 |
| Molecular Formula | C10H12BrF3N2 |
| Molecular Weight | 297.12 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 5-bromo-4-methyl-N-(4,4,4-trifluorobutyl)pyridin-2-amine |
| SMILES | Cc1cc(NCCCC(F)(F)F)ncc1Br |
| InChI | InChI=1S/C10H12BrF3N2/c1-7-5-9(16-6-8(7)11)15-4-2-3-10(12,13)14/h5-6H,2-4H2,1H3,(H,15,16) |
| InChIKey | KQGTUFCFVVAJJX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.12 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|