C10H16BrN3 — CID 114869070
N'-(5-bromo-4-methyl-2-pyridinyl)butane-1,4-diamine (PubChem CID 114869070) has the molecular formula C10H16BrN3 and a molecular weight of 258.16 g/mol. Its IUPAC name is N'-(5-bromo-4-methyl-2-pyridinyl)butane-1,4-diamine.
| Compound Name | N'-(5-bromo-4-methyl-2-pyridinyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 114869070 |
| Molecular Formula | C10H16BrN3 |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | N'-(5-bromo-4-methyl-2-pyridinyl)butane-1,4-diamine |
| SMILES | Cc1cc(NCCCCN)ncc1Br |
| InChI | InChI=1S/C10H16BrN3/c1-8-6-10(14-7-9(8)11)13-5-3-2-4-12/h6-7H,2-5,12H2,1H3,(H,13,14) |
| InChIKey | SEEJJTZDBREPNL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|