C11H15BrN2 — CID 130655433
5-bromo-4-methyl-N-(2-methylidenebutyl)pyridin-2-amine (PubChem CID 130655433) has the molecular formula C11H15BrN2 and a molecular weight of 255.16 g/mol. Its IUPAC name is 5-bromo-4-methyl-N-(2-methylidenebutyl)pyridin-2-amine.
| Compound Name | 5-bromo-4-methyl-N-(2-methylidenebutyl)pyridin-2-amine |
|---|---|
| PubChem CID | 130655433 |
| Molecular Formula | C11H15BrN2 |
| Molecular Weight | 255.16 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 5-bromo-4-methyl-N-(2-methylidenebutyl)pyridin-2-amine |
| SMILES | C=C(CC)CNc1cc(C)c(Br)cn1 |
| InChI | InChI=1S/C11H15BrN2/c1-4-8(2)6-13-11-5-9(3)10(12)7-14-11/h5,7H,2,4,6H2,1,3H3,(H,13,14) |
| InChIKey | GLFIEIBYUQBQJO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.16 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|