C9H12BrN3 — CID 131054209
6-bromo-N-(2-methylidenebutyl)pyrimidin-4-amine (PubChem CID 131054209) has the molecular formula C9H12BrN3 and a molecular weight of 242.12 g/mol. Its IUPAC name is 6-bromo-N-(2-methylidenebutyl)pyrimidin-4-amine.
| Compound Name | 6-bromo-N-(2-methylidenebutyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 131054209 |
| Molecular Formula | C9H12BrN3 |
| Molecular Weight | 242.12 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 6-bromo-N-(2-methylidenebutyl)pyrimidin-4-amine |
| SMILES | C=C(CC)CNc1cc(Br)ncn1 |
| InChI | InChI=1S/C9H12BrN3/c1-3-7(2)5-11-9-4-8(10)12-6-13-9/h4,6H,2-3,5H2,1H3,(H,11,12,13) |
| InChIKey | ZBHSYDZWSVDBCF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.12 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|