C10H15N3 — CID 131071652
6-methyl-N-(2-methylidenebutyl)pyrimidin-4-amine (PubChem CID 131071652) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 6-methyl-N-(2-methylidenebutyl)pyrimidin-4-amine.
| Compound Name | 6-methyl-N-(2-methylidenebutyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 131071652 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 6-methyl-N-(2-methylidenebutyl)pyrimidin-4-amine |
| SMILES | C=C(CC)CNc1cc(C)ncn1 |
| InChI | InChI=1S/C10H15N3/c1-4-8(2)6-11-10-5-9(3)12-7-13-10/h5,7H,2,4,6H2,1,3H3,(H,11,12,13) |
| InChIKey | VZYWTIZMKRHOQF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|